C33H44N5O12S2Si+ — CID 102236132
[10-[5-azido-2,4-bis[2-(2-sulfooxyethoxy)ethoxy]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 102236132) has the molecular formula C33H44N5O12S2Si+ and a molecular weight of 794.96 g/mol. Its IUPAC name is [10-[5-azido-2,4-bis[2-(2-sulfooxyethoxy)ethoxy]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [10-[5-azido-2,4-bis[2-(2-sulfooxyethoxy)ethoxy]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 102236132 |
| Molecular Formula | C33H44N5O12S2Si+ |
| Molecular Weight | 794.96 g/mol |
| Exact Mass | 794.22 |
| IUPAC Name | [10-[5-azido-2,4-bis[2-(2-sulfooxyethoxy)ethoxy]phenyl]-7-(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)[Si](C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1cc(N=[N+]=[N-])c(OCCOCCOS(=O)(=O)O)cc1OCCOCCOS(=O)(=O)O |
| InChI | InChI=1S/C33H43N5O12S2Si/c1-37(2)23-7-9-25-31(19-23)53(5,6)32-20-24(38(3)4)8-10-26(32)33(25)27-21-28(35-36-34)30(48-16-12-46-14-18-50-52(42,43)44)22-29(27)47-15-11-45-13-17-49-51(39,40)41/h7-10,19-22H,11-18H2,1-6H3,(H-,39,40,41,42,43,44)/p+1 |
| InChIKey | YEGMRMYKQWSGJM-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 219.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.96 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|