C32H41N4O12S2Si+ — CID 157138153
[10-[5-azido-2,4-bis[2-(2-sulfooxyethoxy)ethoxy]phenyl]-5,5,7-trimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium (PubChem CID 157138153) has the molecular formula C32H41N4O12S2Si+ and a molecular weight of 765.92 g/mol. Its IUPAC name is [10-[5-azido-2,4-bis[2-(2-sulfooxyethoxy)ethoxy]phenyl]-5,5,7-trimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium.
| Compound Name | [10-[5-azido-2,4-bis[2-(2-sulfooxyethoxy)ethoxy]phenyl]-5,5,7-trimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 157138153 |
| Molecular Formula | C32H41N4O12S2Si+ |
| Molecular Weight | 765.92 g/mol |
| Exact Mass | 765.19 |
| IUPAC Name | [10-[5-azido-2,4-bis[2-(2-sulfooxyethoxy)ethoxy]phenyl]-5,5,7-trimethylbenzo[b][1]benzosilin-3-ylidene]-dimethylazanium |
| SMILES | Cc1ccc2c(c1)[Si](C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1cc(N=[N+]=[N-])c(OCCOCCOS(=O)(=O)O)cc1OCCOCCOS(=O)(=O)O |
| InChI | InChI=1S/C32H40N4O12S2Si/c1-22-6-8-24-30(18-22)51(4,5)31-19-23(36(2)3)7-9-25(31)32(24)26-20-27(34-35-33)29(46-15-11-44-13-17-48-50(40,41)42)21-28(26)45-14-10-43-12-16-47-49(37,38)39/h6-9,18-21H,10-17H2,1-5H3,(H-,37,38,39,40,41,42)/p+1 |
| InChIKey | AJWHFHVUCFNAIM-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 215.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.92 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|