C33H41N3O3Si — CID 153280586
4-[[2-[7-(ethylamino)-3-ethylimino-2,5,5,8-tetramethylbenzo[b][1]benzosilin-10-yl]benzoyl]-methylamino]butanoic acid (PubChem CID 153280586) has the molecular formula C33H41N3O3Si and a molecular weight of 555.80 g/mol. Its IUPAC name is 4-[[2-[7-(ethylamino)-3-ethylimino-2,5,5,8-tetramethylbenzo[b][1]benzosilin-10-yl]benzoyl]-methylamino]butanoic acid.
| Compound Name | 4-[[2-[7-(ethylamino)-3-ethylimino-2,5,5,8-tetramethylbenzo[b][1]benzosilin-10-yl]benzoyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 153280586 |
| Molecular Formula | C33H41N3O3Si |
| Molecular Weight | 555.80 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | 4-[[2-[7-(ethylamino)-3-ethylimino-2,5,5,8-tetramethylbenzo[b][1]benzosilin-10-yl]benzoyl]-methylamino]butanoic acid |
| SMILES | CC/N=C1\C=C2C(=C(c3ccccc3C(=O)N(C)CCCC(=O)O)c3cc(C)c(NCC)cc3[Si]2(C)C)C=C1C |
| InChI | InChI=1S/C33H41N3O3Si/c1-8-34-27-19-29-25(17-21(27)3)32(26-18-22(4)28(35-9-2)20-30(26)40(29,6)7)23-13-10-11-14-24(23)33(39)36(5)16-12-15-31(37)38/h10-11,13-14,17-20,34H,8-9,12,15-16H2,1-7H3,(H,37,38)/b35-28+ |
| InChIKey | BWBIPWPMAAXTKO-AWQADKOQSA-N |
| XLogP | 5.98 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.80 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|