C30H36N2O6 — CID 137048830
5-(3-carboxypropoxy)-2-[(E)-[4-(ethylamino)-2-hydroxy-5-methylphenyl]-(4-ethylimino-3-methylcyclohex-2-en-1-ylidene)methyl]benzoic acid (PubChem CID 137048830) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is 5-(3-carboxypropoxy)-2-[(E)-[4-(ethylamino)-2-hydroxy-5-methylphenyl]-(4-ethylimino-3-methylcyclohex-2-en-1-ylidene)methyl]benzoic acid.
| Compound Name | 5-(3-carboxypropoxy)-2-[(E)-[4-(ethylamino)-2-hydroxy-5-methylphenyl]-(4-ethylimino-3-methylcyclohex-2-en-1-ylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 137048830 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 5-(3-carboxypropoxy)-2-[(E)-[4-(ethylamino)-2-hydroxy-5-methylphenyl]-(4-ethylimino-3-methylcyclohex-2-en-1-ylidene)methyl]benzoic acid |
| SMILES | CC/N=C1\CC/C(=C(\c2cc(C)c(NCC)cc2O)c2ccc(OCCCC(=O)O)cc2C(=O)O)C=C1C |
| InChI | InChI=1S/C30H36N2O6/c1-5-31-25-12-9-20(14-18(25)3)29(24-15-19(4)26(32-6-2)17-27(24)33)22-11-10-21(16-23(22)30(36)37)38-13-7-8-28(34)35/h10-11,14-17,32-33H,5-9,12-13H2,1-4H3,(H,34,35)(H,36,37)/b29-20+,31-25+ |
| InChIKey | ILDBDMCJVNDETB-NQTAQMEVSA-N |
| XLogP | 6.08 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|