About 5-hexoxy-2-methylbenzoic acid;hydrochloride
5-hexoxy-2-methylbenzoic acid;hydrochloride (PubChem CID 129135578) has the molecular formula C14H21ClO3
and a molecular weight of 272.77 g/mol. Its IUPAC name is 5-hexoxy-2-methylbenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 5-hexoxy-2-methylbenzoic acid;hydrochloride |
| PubChem CID | 129135578 |
| Molecular Formula | C14H21ClO3 |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 5-hexoxy-2-methylbenzoic acid;hydrochloride |
| SMILES | CCCCCCOc1ccc(C)c(C(=O)O)c1.Cl |
| InChI | InChI=1S/C14H20O3.ClH/c1-3-4-5-6-9-17-12-8-7-11(2)13(10-12)14(15)16;/h7-8,10H,3-6,9H2,1-2H3,(H,15,16);1H |
| InChIKey | FKOFMBFUNADZNR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexoxy-2-methylbenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexoxy-2-methylbenzoic acid;hydrochloride?
The IUPAC name of 5-hexoxy-2-methylbenzoic acid;hydrochloride (CID 129135578) is 5-hexoxy-2-methylbenzoic acid;hydrochloride.
What is the SMILES notation for 5-hexoxy-2-methylbenzoic acid;hydrochloride?
The canonical SMILES for 5-hexoxy-2-methylbenzoic acid;hydrochloride is CCCCCCOc1ccc(C)c(C(=O)O)c1.Cl.
What is the InChIKey of 5-hexoxy-2-methylbenzoic acid;hydrochloride?
The InChIKey is FKOFMBFUNADZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3.ClH/c1-3-4-5-6-9-17-12-8-7-11(2)13(10-12)14(15)16;/h7-8,10H,3-6,9H2,1-2H3,(H,15,16);1H.
What are the key properties of 5-hexoxy-2-methylbenzoic acid;hydrochloride?
5-hexoxy-2-methylbenzoic acid;hydrochloride has a molecular weight of 272.77 g/mol, XLogP of 4.07, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexoxy-2-methylbenzoic acid;hydrochloride is sourced from PubChem (CID 129135578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).