C42H34F3N4O4+ — CID 162450268
[10-[2-carboxy-5-[dicyano(methoxymethoxy)methyl]-3,4,6-trifluorophenyl]-9,9-dimethyl-7-(N-methylanilino)anthracen-2-ylidene]-methyl-phenylazanium (PubChem CID 162450268) has the molecular formula C42H34F3N4O4+ and a molecular weight of 715.75 g/mol. Its IUPAC name is [10-[2-carboxy-5-[dicyano(methoxymethoxy)methyl]-3,4,6-trifluorophenyl]-9,9-dimethyl-7-(N-methylanilino)anthracen-2-ylidene]-methyl-phenylazanium.
| Compound Name | [10-[2-carboxy-5-[dicyano(methoxymethoxy)methyl]-3,4,6-trifluorophenyl]-9,9-dimethyl-7-(N-methylanilino)anthracen-2-ylidene]-methyl-phenylazanium |
|---|---|
| PubChem CID | 162450268 |
| Molecular Formula | C42H34F3N4O4+ |
| Molecular Weight | 715.75 g/mol |
| Exact Mass | 715.25 |
| IUPAC Name | [10-[2-carboxy-5-[dicyano(methoxymethoxy)methyl]-3,4,6-trifluorophenyl]-9,9-dimethyl-7-(N-methylanilino)anthracen-2-ylidene]-methyl-phenylazanium |
| SMILES | COCOC(C#N)(C#N)c1c(F)c(F)c(C(=O)O)c(C2=C3C=C/C(=[N+](/C)c4ccccc4)C=C3C(C)(C)c3cc(N(C)c4ccccc4)ccc32)c1F |
| InChI | InChI=1S/C42H33F3N4O4/c1-41(2)31-20-27(48(3)25-12-8-6-9-13-25)16-18-29(31)33(30-19-17-28(21-32(30)41)49(4)26-14-10-7-11-15-26)34-35(40(50)51)38(44)39(45)36(37(34)43)42(22-46,23-47)53-24-52-5/h6-21H,24H2,1-5H3/p+1 |
| InChIKey | JYGQZXOGCVNYRS-UHFFFAOYSA-O |
| XLogP | 8.44 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.75 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|