C26H38N2O3P+ — CID 140893315
[7-(dimethylamino)-10-di(propan-2-yloxy)phosphoryl-9,9-dimethylanthracen-2-ylidene]-dimethylazanium (PubChem CID 140893315) has the molecular formula C26H38N2O3P+ and a molecular weight of 457.58 g/mol. Its IUPAC name is [7-(dimethylamino)-10-di(propan-2-yloxy)phosphoryl-9,9-dimethylanthracen-2-ylidene]-dimethylazanium.
| Compound Name | [7-(dimethylamino)-10-di(propan-2-yloxy)phosphoryl-9,9-dimethylanthracen-2-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 140893315 |
| Molecular Formula | C26H38N2O3P+ |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | [7-(dimethylamino)-10-di(propan-2-yloxy)phosphoryl-9,9-dimethylanthracen-2-ylidene]-dimethylazanium |
| SMILES | CC(C)OP(=O)(OC(C)C)C1=C2C=CC(=[N+](C)C)C=C2C(C)(C)c2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C26H38N2O3P/c1-17(2)30-32(29,31-18(3)4)25-21-13-11-19(27(7)8)15-23(21)26(5,6)24-16-20(28(9)10)12-14-22(24)25/h11-18H,1-10H3/q+1 |
| InChIKey | GHERTCXDHHFQIP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 41.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|