C24H35N2O+ — CID 170787544
[7-(dimethylamino)-10-(1-hydroxyethyl)-9,9-dimethylanthracen-2-ylidene]-dimethylazanium;ethane (PubChem CID 170787544) has the molecular formula C24H35N2O+ and a molecular weight of 367.56 g/mol. Its IUPAC name is [7-(dimethylamino)-10-(1-hydroxyethyl)-9,9-dimethylanthracen-2-ylidene]-dimethylazanium;ethane.
| Compound Name | [7-(dimethylamino)-10-(1-hydroxyethyl)-9,9-dimethylanthracen-2-ylidene]-dimethylazanium;ethane |
|---|---|
| PubChem CID | 170787544 |
| Molecular Formula | C24H35N2O+ |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | [7-(dimethylamino)-10-(1-hydroxyethyl)-9,9-dimethylanthracen-2-ylidene]-dimethylazanium;ethane |
| SMILES | CC.CC(O)C1=C2C=CC(=[N+](C)C)C=C2C(C)(C)c2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C22H29N2O.C2H6/c1-14(25)21-17-10-8-15(23(4)5)12-19(17)22(2,3)20-13-16(24(6)7)9-11-18(20)21;1-2/h8-14,25H,1-7H3;1-2H3/q+1; |
| InChIKey | GDOHXFRUARINHU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|