C17H23N — CID 22088221
N,N,5,6,8,8-hexamethyl-7-methylidenenaphthalen-2-amine (PubChem CID 22088221) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is N,N,5,6,8,8-hexamethyl-7-methylidenenaphthalen-2-amine.
| Compound Name | N,N,5,6,8,8-hexamethyl-7-methylidenenaphthalen-2-amine |
|---|---|
| PubChem CID | 22088221 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N,N,5,6,8,8-hexamethyl-7-methylidenenaphthalen-2-amine |
| SMILES | C=C1C(C)=C(C)c2ccc(N(C)C)cc2C1(C)C |
| InChI | InChI=1S/C17H23N/c1-11-12(2)15-9-8-14(18(6)7)10-16(15)17(4,5)13(11)3/h8-10H,3H2,1-2,4-7H3 |
| InChIKey | JXTYXGMQRYLOHY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|