C22H29N2+ — CID 23528837
[7-(dimethylamino)-9,9-diethylanthracen-2-ylidene]-dimethylazanium (PubChem CID 23528837) has the molecular formula C22H29N2+ and a molecular weight of 321.49 g/mol. Its IUPAC name is [7-(dimethylamino)-9,9-diethylanthracen-2-ylidene]-dimethylazanium.
| Compound Name | [7-(dimethylamino)-9,9-diethylanthracen-2-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 23528837 |
| Molecular Formula | C22H29N2+ |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | [7-(dimethylamino)-9,9-diethylanthracen-2-ylidene]-dimethylazanium |
| SMILES | CCC1(CC)C2=CC(=[N+](C)C)C=CC2=Cc2ccc(N(C)C)cc21 |
| InChI | InChI=1S/C22H29N2/c1-7-22(8-2)20-14-18(23(3)4)11-9-16(20)13-17-10-12-19(24(5)6)15-21(17)22/h9-15H,7-8H2,1-6H3/q+1 |
| InChIKey | RVTBBNIFNHDEAA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|