C23H33N2+ — CID 158364674
[7-(diethylamino)-9,9-dimethylanthracen-2-ylidene]-dimethylazanium;methane (PubChem CID 158364674) has the molecular formula C23H33N2+ and a molecular weight of 337.53 g/mol. Its IUPAC name is [7-(diethylamino)-9,9-dimethylanthracen-2-ylidene]-dimethylazanium;methane.
| Compound Name | [7-(diethylamino)-9,9-dimethylanthracen-2-ylidene]-dimethylazanium;methane |
|---|---|
| PubChem CID | 158364674 |
| Molecular Formula | C23H33N2+ |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | [7-(diethylamino)-9,9-dimethylanthracen-2-ylidene]-dimethylazanium;methane |
| SMILES | C.CCN(CC)c1ccc2c(c1)C(C)(C)C1=CC(=[N+](C)C)C=CC1=C2 |
| InChI | InChI=1S/C22H29N2.CH4/c1-7-24(8-2)19-12-10-17-13-16-9-11-18(23(5)6)14-20(16)22(3,4)21(17)15-19;/h9-15H,7-8H2,1-6H3;1H4/q+1; |
| InChIKey | KPAXEVYUWFSYQT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|