C13H17NO — CID 10750672
N,N-diethyl-2H-chromen-7-amine (PubChem CID 10750672) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is N,N-diethyl-2H-chromen-7-amine.
| Compound Name | N,N-diethyl-2H-chromen-7-amine |
|---|---|
| PubChem CID | 10750672 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N,N-diethyl-2H-chromen-7-amine |
| SMILES | CCN(CC)c1ccc2c(c1)OCC=C2 |
| InChI | InChI=1S/C13H17NO/c1-3-14(4-2)12-8-7-11-6-5-9-15-13(11)10-12/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | OSUYDVDWYHEXPZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|