C11H14N2O3S — CID 155535074
N,N-diethyl-2,2-dioxo-1,2λ6,3-benzoxathiazin-7-amine (PubChem CID 155535074) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N,N-diethyl-2,2-dioxo-1,2λ6,3-benzoxathiazin-7-amine.
| Compound Name | N,N-diethyl-2,2-dioxo-1,2λ6,3-benzoxathiazin-7-amine |
|---|---|
| PubChem CID | 155535074 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N,N-diethyl-2,2-dioxo-1,2λ6,3-benzoxathiazin-7-amine |
| SMILES | CCN(CC)c1ccc2c(c1)OS(=O)(=O)N=C2 |
| InChI | InChI=1S/C11H14N2O3S/c1-3-13(4-2)10-6-5-9-8-12-17(14,15)16-11(9)7-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | GOJPRPHLXDDKFX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |