C25H36N4O2 — CID 102485913
3,7-bis(diethylamino)-N,N-diethylphenoxazine-10-carboxamide (PubChem CID 102485913) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 3,7-bis(diethylamino)-N,N-diethylphenoxazine-10-carboxamide.
| Compound Name | 3,7-bis(diethylamino)-N,N-diethylphenoxazine-10-carboxamide |
|---|---|
| PubChem CID | 102485913 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 3,7-bis(diethylamino)-N,N-diethylphenoxazine-10-carboxamide |
| SMILES | CCN(CC)C(=O)N1c2ccc(N(CC)CC)cc2Oc2cc(N(CC)CC)ccc21 |
| InChI | InChI=1S/C25H36N4O2/c1-7-26(8-2)19-13-15-21-23(17-19)31-24-18-20(27(9-3)10-4)14-16-22(24)29(21)25(30)28(11-5)12-6/h13-18H,7-12H2,1-6H3 |
| InChIKey | XACDXKYVIXIYRT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |