C28H33N3O3 — CID 11259695
benzyl 3,7-bis(diethylamino)phenoxazine-10-carboxylate (PubChem CID 11259695) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is benzyl 3,7-bis(diethylamino)phenoxazine-10-carboxylate.
| Compound Name | benzyl 3,7-bis(diethylamino)phenoxazine-10-carboxylate |
|---|---|
| PubChem CID | 11259695 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | benzyl 3,7-bis(diethylamino)phenoxazine-10-carboxylate |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H33N3O3/c1-5-29(6-2)22-14-16-24-26(18-22)34-27-19-23(30(7-3)8-4)15-17-25(27)31(24)28(32)33-20-21-12-10-9-11-13-21/h9-19H,5-8,20H2,1-4H3 |
| InChIKey | BZGGCJQAGZMBGB-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |