C34H34N4O2 — CID 87780768
acridin-9-yl-[3,7-bis(diethylamino)phenoxazin-10-yl]methanone (PubChem CID 87780768) has the molecular formula C34H34N4O2 and a molecular weight of 530.67 g/mol. Its IUPAC name is acridin-9-yl-[3,7-bis(diethylamino)phenoxazin-10-yl]methanone.
| Compound Name | acridin-9-yl-[3,7-bis(diethylamino)phenoxazin-10-yl]methanone |
|---|---|
| PubChem CID | 87780768 |
| Molecular Formula | C34H34N4O2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | acridin-9-yl-[3,7-bis(diethylamino)phenoxazin-10-yl]methanone |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1N2C(=O)c1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C34H34N4O2/c1-5-36(6-2)23-17-19-29-31(21-23)40-32-22-24(37(7-3)8-4)18-20-30(32)38(29)34(39)33-25-13-9-11-15-27(25)35-28-16-12-10-14-26(28)33/h9-22H,5-8H2,1-4H3 |
| InChIKey | SKAWVJXJQOMYON-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|