C36H55N5O10S — CID 102485866
S-[2-[6-[[(2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]amino]hexylamino]-2-oxoethyl] 3,7-bis(diethylamino)phenoxazine-10-carbothioate (PubChem CID 102485866) has the molecular formula C36H55N5O10S and a molecular weight of 749.93 g/mol. Its IUPAC name is S-[2-[6-[[(2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]amino]hexylamino]-2-oxoethyl] 3,7-bis(diethylamino)phenoxazine-10-carbothioate.
| Compound Name | S-[2-[6-[[(2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]amino]hexylamino]-2-oxoethyl] 3,7-bis(diethylamino)phenoxazine-10-carbothioate |
|---|---|
| PubChem CID | 102485866 |
| Molecular Formula | C36H55N5O10S |
| Molecular Weight | 749.93 g/mol |
| Exact Mass | 749.37 |
| IUPAC Name | S-[2-[6-[[(2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]amino]hexylamino]-2-oxoethyl] 3,7-bis(diethylamino)phenoxazine-10-carbothioate |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1N2C(=O)SCC(=O)NCCCCCCNC(=O)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C36H55N5O10S/c1-5-39(6-2)23-13-15-25-28(19-23)51-29-20-24(40(7-3)8-4)14-16-26(29)41(25)36(50)52-22-30(44)37-17-11-9-10-12-18-38-35(49)34(48)33(47)32(46)31(45)27(43)21-42/h13-16,19-20,27,31-34,42-43,45-48H,5-12,17-18,21-22H2,1-4H3,(H,37,44)(H,38,49)/t27-,31-,32+,33-,34-/m1/s1 |
| InChIKey | JVTRIISHLFNLOA-CPDSMYKJSA-N |
| XLogP | 2.07 |
| TPSA | 215.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.93 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|