C11H14N2O — CID 10821519
N,N-diethyl-1,2-benzoxazol-6-amine (PubChem CID 10821519) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is N,N-diethyl-1,2-benzoxazol-6-amine.
| Compound Name | N,N-diethyl-1,2-benzoxazol-6-amine |
|---|---|
| PubChem CID | 10821519 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N,N-diethyl-1,2-benzoxazol-6-amine |
| SMILES | CCN(CC)c1ccc2cnoc2c1 |
| InChI | InChI=1S/C11H14N2O/c1-3-13(4-2)10-6-5-9-8-12-14-11(9)7-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | SIJINTKNDJBLTF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |