About N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine
N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine (PubChem CID 141096500) has the molecular formula C21H22N2O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine.
Molecular Properties
| Compound Name | N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine |
| PubChem CID | 141096500 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine |
| SMILES | CCN(CC)c1ccc2c(c1)OCC(c1nc3cc(C)ccc3o1)=C2 |
| InChI | InChI=1S/C21H22N2O2/c1-4-23(5-2)17-8-7-15-11-16(13-24-20(15)12-17)21-22-18-10-14(3)6-9-19(18)25-21/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | RVBVPAQWCHGJQS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine?
The IUPAC name of N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine (CID 141096500) is N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine.
What is the SMILES notation for N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine?
The canonical SMILES for N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine is CCN(CC)c1ccc2c(c1)OCC(c1nc3cc(C)ccc3o1)=C2.
What is the InChIKey of N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine?
The InChIKey is RVBVPAQWCHGJQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O2/c1-4-23(5-2)17-8-7-15-11-16(13-24-20(15)12-17)21-22-18-10-14(3)6-9-19(18)25-21/h6-12H,4-5,13H2,1-3H3.
What are the key properties of N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine?
N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine has a molecular weight of 334.42 g/mol, XLogP of 4.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-3-(5-methyl-1,3-benzoxazol-2-yl)-2H-chromen-7-amine is sourced from PubChem (CID 141096500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).