C23H23N2+ — CID 58596196
[6-(dimethylamino)-9-phenylfluoren-3-ylidene]-dimethylazanium (PubChem CID 58596196) has the molecular formula C23H23N2+ and a molecular weight of 327.45 g/mol. Its IUPAC name is [6-(dimethylamino)-9-phenylfluoren-3-ylidene]-dimethylazanium.
| Compound Name | [6-(dimethylamino)-9-phenylfluoren-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 58596196 |
| Molecular Formula | C23H23N2+ |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | [6-(dimethylamino)-9-phenylfluoren-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)C1=CC(=[N+](C)C)C=CC1=C2c1ccccc1 |
| InChI | InChI=1S/C23H23N2/c1-24(2)17-10-12-19-21(14-17)22-15-18(25(3)4)11-13-20(22)23(19)16-8-6-5-7-9-16/h5-15H,1-4H3/q+1 |
| InChIKey | UWFLSQYMMYFFLY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|