C38H45N2OS+ — CID 153384984
[6-(dimethylamino)-9-[10-ethyl-9-(hydroxymethyl)anthracen-2-yl]-10,10-dimethylthioxanthen-3-ylidene]-dimethylazanium;ethane (PubChem CID 153384984) has the molecular formula C38H45N2OS+ and a molecular weight of 577.86 g/mol. Its IUPAC name is [6-(dimethylamino)-9-[10-ethyl-9-(hydroxymethyl)anthracen-2-yl]-10,10-dimethylthioxanthen-3-ylidene]-dimethylazanium;ethane.
| Compound Name | [6-(dimethylamino)-9-[10-ethyl-9-(hydroxymethyl)anthracen-2-yl]-10,10-dimethylthioxanthen-3-ylidene]-dimethylazanium;ethane |
|---|---|
| PubChem CID | 153384984 |
| Molecular Formula | C38H45N2OS+ |
| Molecular Weight | 577.86 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | [6-(dimethylamino)-9-[10-ethyl-9-(hydroxymethyl)anthracen-2-yl]-10,10-dimethylthioxanthen-3-ylidene]-dimethylazanium;ethane |
| SMILES | CC.CCc1c2ccccc2c(CO)c2cc(C3=C4C=CC(=[N+](C)C)C=C4S(C)(C)c4cc(N(C)C)ccc43)ccc12 |
| InChI | InChI=1S/C36H39N2OS.C2H6/c1-8-26-27-11-9-10-12-28(27)33(22-39)32-19-23(13-16-29(26)32)36-30-17-14-24(37(2)3)20-34(30)40(6,7)35-21-25(38(4)5)15-18-31(35)36;1-2/h9-21,39H,8,22H2,1-7H3;1-2H3/q+1; |
| InChIKey | WWCLZFOKTSLPAC-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.86 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|