C27H28N2O4Si — CID 164517277
3',7'-bis(dimethylamino)-5',5'-dimethyl-1-oxospiro[2-benzofuran-3,10'-benzo[b][1]benzosiline]-5-carboxylic acid (PubChem CID 164517277) has the molecular formula C27H28N2O4Si and a molecular weight of 472.62 g/mol. Its IUPAC name is 3',7'-bis(dimethylamino)-5',5'-dimethyl-1-oxospiro[2-benzofuran-3,10'-benzo[b][1]benzosiline]-5-carboxylic acid.
| Compound Name | 3',7'-bis(dimethylamino)-5',5'-dimethyl-1-oxospiro[2-benzofuran-3,10'-benzo[b][1]benzosiline]-5-carboxylic acid |
|---|---|
| PubChem CID | 164517277 |
| Molecular Formula | C27H28N2O4Si |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 3',7'-bis(dimethylamino)-5',5'-dimethyl-1-oxospiro[2-benzofuran-3,10'-benzo[b][1]benzosiline]-5-carboxylic acid |
| SMILES | CN(C)c1ccc2c(c1)[Si](C)(C)c1cc(N(C)C)ccc1C21OC(=O)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C27H28N2O4Si/c1-28(2)17-8-11-20-23(14-17)34(5,6)24-15-18(29(3)4)9-12-21(24)27(20)22-13-16(25(30)31)7-10-19(22)26(32)33-27/h7-15H,1-6H3,(H,30,31) |
| InChIKey | QDXBSEDMYNDYJW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|