About Sir-6-cooh
Sir-6-cooh (PubChem CID 164517277) has the molecular formula C27H28N2O4Si
and a molecular weight of 472.60 g/mol. Its IUPAC name is 3',7'-bis(dimethylamino)-5',5'-dimethyl-1-oxospiro[2-benzofuran-3,10'-benzo[b][1]benzosiline]-5-carboxylic acid.
Molecular Properties
| Compound Name | Sir-6-cooh |
| PubChem CID | 164517277 |
| Molecular Formula | C27H28N2O4Si |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 3',7'-bis(dimethylamino)-5',5'-dimethyl-1-oxospiro[2-benzofuran-3,10'-benzo[b][1]benzosiline]-5-carboxylic acid |
| SMILES | CN(C)C1=CC2=C(C=C1)C3(C4=C([Si]2(C)C)C=C(C=C4)N(C)C)C5=C(C=CC(=C5)C(=O)O)C(=O)O3 |
| InChI | InChI=1S/C27H28N2O4Si/c1-28(2)17-8-11-20-23(14-17)34(5,6)24-15-18(29(3)4)9-12-21(24)27(20)22-13-16(25(30)31)7-10-19(22)26(32)33-27/h7-15H,1-6H3,(H,30,31) |
| InChIKey | QDXBSEDMYNDYJW-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 70.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | 793 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Sir-6-cooh with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sir-6-cooh?
The IUPAC name of Sir-6-cooh (CID 164517277) is 3',7'-bis(dimethylamino)-5',5'-dimethyl-1-oxospiro[2-benzofuran-3,10'-benzo[b][1]benzosiline]-5-carboxylic acid.
What is the SMILES notation for Sir-6-cooh?
The canonical SMILES for Sir-6-cooh is CN(C)C1=CC2=C(C=C1)C3(C4=C([Si]2(C)C)C=C(C=C4)N(C)C)C5=C(C=CC(=C5)C(=O)O)C(=O)O3.
What is the InChIKey of Sir-6-cooh?
The InChIKey is QDXBSEDMYNDYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N2O4Si/c1-28(2)17-8-11-20-23(14-17)34(5,6)24-15-18(29(3)4)9-12-21(24)27(20)22-13-16(25(30)31)7-10-19(22)26(32)33-27/h7-15H,1-6H3,(H,30,31).
What are the key properties of Sir-6-cooh?
Sir-6-cooh has a molecular weight of 472.60 g/mol, XLogP of not available, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Sir-6-cooh is sourced from PubChem (CID 164517277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).