C88H98N8O10Si3 — CID 159608068
CID 159608068 (PubChem CID 159608068) has the molecular formula C88H98N8O10Si3 and a molecular weight of 1512.06 g/mol.
| Compound Name | CID 159608068 |
|---|---|
| PubChem CID | 159608068 |
| Molecular Formula | C88H98N8O10Si3 |
| Molecular Weight | 1512.06 g/mol |
| Exact Mass | 1510.67 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc2c(c1)[Si]1(CCCCC1)c1cc(N(C)C)ccc1C21OC(=O)c2ccc(C(=O)NCCN3C(=O)C=CC3=O)cc21.CN(C)c1ccc2c(c1)[Si]1(CCCCC1)c1cc(N(C)C)ccc1C21OC(=O)c2ccc(C(=O)O)cc21.CN(C)c1ccc2c(c1)[Si]1(CCCCC1)c1cc(N(C)C)ccc1C2=O |
| InChI | InChI=1S/C36H38N4O5Si.C30H32N2O4Si.C22H28N2OSi/c1-38(2)24-9-12-27-30(21-24)46(18-6-5-7-19-46)31-22-25(39(3)4)10-13-28(31)36(27)29-20-23(8-11-26(29)35(44)45-36)34(43)37-16-17-40-32(41)14-15-33(40)42;1-31(2)20-9-12-23-26(17-20)37(14-6-5-7-15-37)27-18-21(32(3)4)10-13-24(27)30(23)25-16-19(28(33)34)8-11-22(25)29(35)36-30;1-23(2)16-8-10-18-20(14-16)26(12-6-5-7-13-26)21-15-17(24(3)4)9-11-19(21)22(18)25/h8-15,20-22H,5-7,16-19H2,1-4H3,(H,37,43);8-13,16-18H,5-7,14-15H2,1-4H3,(H,33,34);8-11,14-15H,5-7,12-13H2,1-4H3 |
| InChIKey | MMIFZZTZYJMPLY-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 192.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 109 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1512.06 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|