About CID 162460993
CID 162460993 (PubChem CID 162460993) has the molecular formula C36H40N2O4Si
and a molecular weight of 592.81 g/mol.
Molecular Properties
| Compound Name | CID 162460993 |
| PubChem CID | 162460993 |
| Molecular Formula | C36H40N2O4Si |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)c1ccc2c(c1)C(=O)OC21c2ccc(N3CCC3)cc2[Si]2(CCCCC2)c2cc(N3CCC3)ccc21 |
| InChI | InChI=1S/C36H40N2O4Si/c1-35(2,3)41-33(39)24-9-12-28-27(21-24)34(40)42-36(28)29-13-10-25(37-15-7-16-37)22-31(29)43(19-5-4-6-20-43)32-23-26(11-14-30(32)36)38-17-8-18-38/h9-14,21-23H,4-8,15-20H2,1-3H3 |
| InChIKey | HNFWSMSJNOUTDZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162460993 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162460993?
The IUPAC name of CID 162460993 (CID 162460993) is not available.
What is the SMILES notation for CID 162460993?
The canonical SMILES for CID 162460993 is CC(C)(C)OC(=O)c1ccc2c(c1)C(=O)OC21c2ccc(N3CCC3)cc2[Si]2(CCCCC2)c2cc(N3CCC3)ccc21.
What is the InChIKey of CID 162460993?
The InChIKey is HNFWSMSJNOUTDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H40N2O4Si/c1-35(2,3)41-33(39)24-9-12-28-27(21-24)34(40)42-36(28)29-13-10-25(37-15-7-16-37)22-31(29)43(19-5-4-6-20-43)32-23-26(11-14-30(32)36)38-17-8-18-38/h9-14,21-23H,4-8,15-20H2,1-3H3.
What are the key properties of CID 162460993?
CID 162460993 has a molecular weight of 592.81 g/mol, XLogP of 5.58, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162460993 is sourced from PubChem (CID 162460993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).