C32H32N2O4Si — CID 162460991
CID 162460991 (PubChem CID 162460991) has the molecular formula C32H32N2O4Si and a molecular weight of 536.70 g/mol.
| Compound Name | CID 162460991 |
|---|---|
| PubChem CID | 162460991 |
| Molecular Formula | C32H32N2O4Si |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)OC21c2cc3c(cc2[Si]2(CCCCC2)c2cc4c(cc21)CCCN4)NCCC3 |
| InChI | InChI=1S/C32H32N2O4Si/c35-30(36)21-8-9-23-22(14-21)31(37)38-32(23)24-15-19-6-4-10-33-26(19)17-28(24)39(12-2-1-3-13-39)29-18-27-20(16-25(29)32)7-5-11-34-27/h8-9,14-18,33-34H,1-7,10-13H2,(H,35,36) |
| InChIKey | LHJUDPGYCHGPER-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|