C21H11O13S2- — CID 164936718
5-carboxy-3',6'-dihydroxy-3-oxo-5'-sulfospiro[2-benzofuran-1,9'-xanthene]-4'-sulfonate (PubChem CID 164936718) has the molecular formula C21H11O13S2- and a molecular weight of 535.44 g/mol. Its IUPAC name is 5-carboxy-3',6'-dihydroxy-3-oxo-5'-sulfospiro[2-benzofuran-1,9'-xanthene]-4'-sulfonate.
| Compound Name | 5-carboxy-3',6'-dihydroxy-3-oxo-5'-sulfospiro[2-benzofuran-1,9'-xanthene]-4'-sulfonate |
|---|---|
| PubChem CID | 164936718 |
| Molecular Formula | C21H11O13S2- |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 534.96 |
| IUPAC Name | 5-carboxy-3',6'-dihydroxy-3-oxo-5'-sulfospiro[2-benzofuran-1,9'-xanthene]-4'-sulfonate |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)OC21c2ccc(O)c(S(=O)(=O)[O-])c2Oc2c1ccc(O)c2S(=O)(=O)O |
| InChI | InChI=1S/C21H12O13S2/c22-13-5-3-11-15(17(13)35(27,28)29)33-16-12(4-6-14(23)18(16)36(30,31)32)21(11)10-2-1-8(19(24)25)7-9(10)20(26)34-21/h1-7,22-23H,(H,24,25)(H,27,28,29)(H,30,31,32)/p-1 |
| InChIKey | RRWLWRONDIUZQC-UHFFFAOYSA-M |
| XLogP | 1.51 |
| TPSA | 224.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|