C34H34N2O5 — CID 142357647
methyl 11'-ethyl-9'-methyl-3-oxospiro[2-benzofuran-1,14'-3-oxa-9,21-diazahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1(25),2(15),4(13),5(10),11,16-hexaene]-5-carboxylate (PubChem CID 142357647) has the molecular formula C34H34N2O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is methyl 11'-ethyl-9'-methyl-3-oxospiro[2-benzofuran-1,14'-3-oxa-9,21-diazahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1(25),2(15),4(13),5(10),11,16-hexaene]-5-carboxylate.
| Compound Name | methyl 11'-ethyl-9'-methyl-3-oxospiro[2-benzofuran-1,14'-3-oxa-9,21-diazahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1(25),2(15),4(13),5(10),11,16-hexaene]-5-carboxylate |
|---|---|
| PubChem CID | 142357647 |
| Molecular Formula | C34H34N2O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | methyl 11'-ethyl-9'-methyl-3-oxospiro[2-benzofuran-1,14'-3-oxa-9,21-diazahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1(25),2(15),4(13),5(10),11,16-hexaene]-5-carboxylate |
| SMILES | CCc1cc2c(c3c1N(C)CCC3)Oc1c(cc3c4c1CCCN4CCC3)C21OC(=O)c2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C34H34N2O5/c1-4-19-17-26-30(22-9-6-13-35(2)28(19)22)40-31-23-10-7-15-36-14-5-8-20(29(23)36)18-27(31)34(26)25-12-11-21(32(37)39-3)16-24(25)33(38)41-34/h11-12,16-18H,4-10,13-15H2,1-3H3 |
| InChIKey | BWQBVFPNTBIDBR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|