C34H27N3O9S — CID 142434409
N-(6'-hydroxy-3-oxospiro[2-benzofuran-1,10'-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaene]-5-yl)-5-methylsulfonyl-2-nitrobenzamide (PubChem CID 142434409) has the molecular formula C34H27N3O9S and a molecular weight of 653.67 g/mol. Its IUPAC name is N-(6'-hydroxy-3-oxospiro[2-benzofuran-1,10'-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaene]-5-yl)-5-methylsulfonyl-2-nitrobenzamide.
| Compound Name | N-(6'-hydroxy-3-oxospiro[2-benzofuran-1,10'-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaene]-5-yl)-5-methylsulfonyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 142434409 |
| Molecular Formula | C34H27N3O9S |
| Molecular Weight | 653.67 g/mol |
| Exact Mass | 653.15 |
| IUPAC Name | N-(6'-hydroxy-3-oxospiro[2-benzofuran-1,10'-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaene]-5-yl)-5-methylsulfonyl-2-nitrobenzamide |
| SMILES | CS(=O)(=O)c1ccc([N+](=O)[O-])c(C(=O)Nc2ccc3c(c2)C(=O)OC32c3ccc(O)cc3Oc3c2cc2c4c3CCCN4CCC2)c1 |
| InChI | InChI=1S/C34H27N3O9S/c1-47(43,44)21-8-11-28(37(41)42)24(17-21)32(39)35-19-6-9-25-23(15-19)33(40)46-34(25)26-10-7-20(38)16-29(26)45-31-22-5-3-13-36-12-2-4-18(30(22)36)14-27(31)34/h6-11,14-17,38H,2-5,12-13H2,1H3,(H,35,39) |
| InChIKey | QPKQEJJXBHLBMO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.67 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|