C28H18N2O10S — CID 142434408
N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-5-methylsulfonyl-2-nitrobenzamide (PubChem CID 142434408) has the molecular formula C28H18N2O10S and a molecular weight of 574.52 g/mol. Its IUPAC name is N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-5-methylsulfonyl-2-nitrobenzamide.
| Compound Name | N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-5-methylsulfonyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 142434408 |
| Molecular Formula | C28H18N2O10S |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-5-methylsulfonyl-2-nitrobenzamide |
| SMILES | CS(=O)(=O)c1ccc([N+](=O)[O-])c(C(=O)Nc2ccc3c(c2)C(=O)OC32c3ccc(O)cc3Oc3cc(O)ccc32)c1 |
| InChI | InChI=1S/C28H18N2O10S/c1-41(37,38)17-5-9-23(30(35)36)19(13-17)26(33)29-14-2-6-20-18(10-14)27(34)40-28(20)21-7-3-15(31)11-24(21)39-25-12-16(32)4-8-22(25)28/h2-13,31-32H,1H3,(H,29,33) |
| InChIKey | HVAVQRITCHQMEQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 182.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|