C27H23N3O5 — CID 123351107
4-[3-(aminoazaniumyl)-10-(dimethylamino)-3H-benzo[c]xanthen-7-yl]-3-carboxybenzoate (PubChem CID 123351107) has the molecular formula C27H23N3O5 and a molecular weight of 469.50 g/mol. Its IUPAC name is 4-[3-(aminoazaniumyl)-10-(dimethylamino)-3H-benzo[c]xanthen-7-yl]-3-carboxybenzoate.
| Compound Name | 4-[3-(aminoazaniumyl)-10-(dimethylamino)-3H-benzo[c]xanthen-7-yl]-3-carboxybenzoate |
|---|---|
| PubChem CID | 123351107 |
| Molecular Formula | C27H23N3O5 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 4-[3-(aminoazaniumyl)-10-(dimethylamino)-3H-benzo[c]xanthen-7-yl]-3-carboxybenzoate |
| SMILES | CN(C)c1ccc2c(c1)Oc1c3c(ccc1=C2c1ccc(C(=O)[O-])cc1C(=O)O)=CC([NH2+]N)C=C3 |
| InChI | InChI=1S/C27H23N3O5/c1-30(2)17-6-10-20-23(13-17)35-25-18-9-5-16(29-28)11-14(18)3-8-21(25)24(20)19-7-4-15(26(31)32)12-22(19)27(33)34/h3-13,16,29H,28H2,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | HXTQCWRLUAQQGL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|