C28H32N2O3 — CID 59411965
2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid (PubChem CID 59411965) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid.
| Compound Name | 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 59411965 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid |
| SMILES | CCN(CC)c1ccc2c(c1)OC1=CC(N(CC)CC)C=CC1=C2c1ccccc1C(=O)O |
| InChI | InChI=1S/C28H32N2O3/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32/h9-19H,5-8H2,1-4H3,(H,31,32) |
| InChIKey | NGKLMUAXNCHXCP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|