2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid

C28H32N2O3 — CID 59411965

IUPAC2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid
SMILESCCN(CC)c1ccc2c(c1)OC1=CC(N(CC)CC)C=CC1=C2c1ccccc1C(=O)O
InChIInChI=1S/C28H32N2O3/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32/h9-19H,5-8H2,1-4H3,(H,31,32)
InChIKeyNGKLMUAXNCHXCP-UHFFFAOYSA-N
MW444.58 g/mol
LogP5.59
Rot. Bonds8

About 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid

2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid (PubChem CID 59411965) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid.

Molecular Properties

Compound Name2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid
PubChem CID59411965
Molecular FormulaC28H32N2O3
Molecular Weight444.58 g/mol
Exact Mass444.24
IUPAC Name2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid
SMILESCCN(CC)c1ccc2c(c1)OC1=CC(N(CC)CC)C=CC1=C2c1ccccc1C(=O)O
InChIInChI=1S/C28H32N2O3/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32/h9-19H,5-8H2,1-4H3,(H,31,32)
InChIKeyNGKLMUAXNCHXCP-UHFFFAOYSA-N
XLogP5.59
TPSA53.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms33
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500444.58
LogP ≤ 55.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}

Analyze 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid?
The IUPAC name of 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid (CID 59411965) is 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid.
What is the SMILES notation for 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid?
The canonical SMILES for 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid is CCN(CC)c1ccc2c(c1)OC1=CC(N(CC)CC)C=CC1=C2c1ccccc1C(=O)O.
What is the InChIKey of 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid?
The InChIKey is NGKLMUAXNCHXCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H32N2O3/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32/h9-19H,5-8H2,1-4H3,(H,31,32).
What are the key properties of 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid?
2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid has a molecular weight of 444.58 g/mol, XLogP of 5.59, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoic acid is sourced from PubChem (CID 59411965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).