C53H55N4O5P — CID 122363379
methyl 4-[4-[2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoyl]piperazine-1-carbonyl]-2-diphenylphosphanylbenzoate (PubChem CID 122363379) has the molecular formula C53H55N4O5P and a molecular weight of 859.02 g/mol. Its IUPAC name is methyl 4-[4-[2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoyl]piperazine-1-carbonyl]-2-diphenylphosphanylbenzoate.
| Compound Name | methyl 4-[4-[2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoyl]piperazine-1-carbonyl]-2-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 122363379 |
| Molecular Formula | C53H55N4O5P |
| Molecular Weight | 859.02 g/mol |
| Exact Mass | 858.39 |
| IUPAC Name | methyl 4-[4-[2-[3,6-bis(diethylamino)-3H-xanthen-9-yl]benzoyl]piperazine-1-carbonyl]-2-diphenylphosphanylbenzoate |
| SMILES | CCN(CC)c1ccc2c(c1)OC1=CC(N(CC)CC)C=CC1=C2c1ccccc1C(=O)N1CCN(C(=O)c2ccc(C(=O)OC)c(P(c3ccccc3)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C53H55N4O5P/c1-6-54(7-2)38-25-28-44-47(35-38)62-48-36-39(55(8-3)9-4)26-29-45(48)50(44)42-22-16-17-23-43(42)52(59)57-32-30-56(31-33-57)51(58)37-24-27-46(53(60)61-5)49(34-37)63(40-18-12-10-13-19-40)41-20-14-11-15-21-41/h10-29,34-36,38H,6-9,30-33H2,1-5H3 |
| InChIKey | VJZZAYGCJOAZRL-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 82.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.02 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|