C45H45N2O6+ — CID 177435303
[9-(diethylamino)-12,14-bis(2-methoxycarbonylphenyl)-13-methyl-13H-chromeno[3,2-b]xanthen-3-ylidene]-diethylazanium (PubChem CID 177435303) has the molecular formula C45H45N2O6+ and a molecular weight of 709.86 g/mol. Its IUPAC name is [9-(diethylamino)-12,14-bis(2-methoxycarbonylphenyl)-13-methyl-13H-chromeno[3,2-b]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-(diethylamino)-12,14-bis(2-methoxycarbonylphenyl)-13-methyl-13H-chromeno[3,2-b]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 177435303 |
| Molecular Formula | C45H45N2O6+ |
| Molecular Weight | 709.86 g/mol |
| Exact Mass | 709.33 |
| IUPAC Name | [9-(diethylamino)-12,14-bis(2-methoxycarbonylphenyl)-13-methyl-13H-chromeno[3,2-b]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(c1)OC1=Cc3oc4cc(=[N+](CC)CC)ccc-4c(-c4ccccc4C(=O)OC)c3C(C)C1=C2c1ccccc1C(=O)OC |
| InChI | InChI=1S/C45H45N2O6/c1-8-46(9-2)28-20-22-34-36(24-28)52-38-26-39-41(27(5)40(38)42(34)30-16-12-14-18-32(30)44(48)50-6)43(31-17-13-15-19-33(31)45(49)51-7)35-23-21-29(25-37(35)53-39)47(10-3)11-4/h12-27H,8-11H2,1-7H3/q+1 |
| InChIKey | JUNQEGPIIWCZSP-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 81.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.86 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|