C30H34N4O3 — CID 89429416
6-azidohexyl 2-[6-(diethylamino)-3H-xanthen-9-yl]benzoate (PubChem CID 89429416) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 6-azidohexyl 2-[6-(diethylamino)-3H-xanthen-9-yl]benzoate.
| Compound Name | 6-azidohexyl 2-[6-(diethylamino)-3H-xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 89429416 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 6-azidohexyl 2-[6-(diethylamino)-3H-xanthen-9-yl]benzoate |
| SMILES | CCN(CC)c1ccc2c(c1)OC1=CCC=CC1=C2c1ccccc1C(=O)OCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C30H34N4O3/c1-3-34(4-2)22-17-18-26-28(21-22)37-27-16-10-9-15-25(27)29(26)23-13-7-8-14-24(23)30(35)36-20-12-6-5-11-19-32-33-31/h7-9,13-18,21H,3-6,10-12,19-20H2,1-2H3 |
| InChIKey | VZGAJCYQVVOQGY-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|