C28H34N4OS — CID 177387657
(1Z)-2-[6-(diethylamino)-3-(diethylazaniumyl)-3H-xanthen-9-yl]benzenecarbohydrazonothioate (PubChem CID 177387657) has the molecular formula C28H34N4OS and a molecular weight of 474.67 g/mol. Its IUPAC name is (1Z)-2-[6-(diethylamino)-3-(diethylazaniumyl)-3H-xanthen-9-yl]benzenecarbohydrazonothioate.
| Compound Name | (1Z)-2-[6-(diethylamino)-3-(diethylazaniumyl)-3H-xanthen-9-yl]benzenecarbohydrazonothioate |
|---|---|
| PubChem CID | 177387657 |
| Molecular Formula | C28H34N4OS |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (1Z)-2-[6-(diethylamino)-3-(diethylazaniumyl)-3H-xanthen-9-yl]benzenecarbohydrazonothioate |
| SMILES | CCN(CC)c1ccc2c(c1)OC1=CC([NH+](CC)CC)C=CC1=C2c1ccccc1/C([S-])=N/N |
| InChI | InChI=1S/C28H34N4OS/c1-5-31(6-2)19-13-15-23-25(17-19)33-26-18-20(32(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(34)30-29/h9-19H,5-8,29H2,1-4H3,(H,30,34) |
| InChIKey | ZNZSQUQEPSYALN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|