C36H50N4O — CID 90224470
9-[2-[(4-butylpiperazin-1-yl)methyl]phenyl]-3-N,3-N,6-N,6-N-tetraethyl-3H-xanthene-3,6-diamine (PubChem CID 90224470) has the molecular formula C36H50N4O and a molecular weight of 554.82 g/mol. Its IUPAC name is 9-[2-[(4-butylpiperazin-1-yl)methyl]phenyl]-3-N,3-N,6-N,6-N-tetraethyl-3H-xanthene-3,6-diamine.
| Compound Name | 9-[2-[(4-butylpiperazin-1-yl)methyl]phenyl]-3-N,3-N,6-N,6-N-tetraethyl-3H-xanthene-3,6-diamine |
|---|---|
| PubChem CID | 90224470 |
| Molecular Formula | C36H50N4O |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 554.40 |
| IUPAC Name | 9-[2-[(4-butylpiperazin-1-yl)methyl]phenyl]-3-N,3-N,6-N,6-N-tetraethyl-3H-xanthene-3,6-diamine |
| SMILES | CCCCN1CCN(Cc2ccccc2C2=C3C=CC(N(CC)CC)C=C3Oc3cc(N(CC)CC)ccc32)CC1 |
| InChI | InChI=1S/C36H50N4O/c1-6-11-20-37-21-23-38(24-22-37)27-28-14-12-13-15-31(28)36-32-18-16-29(39(7-2)8-3)25-34(32)41-35-26-30(17-19-33(35)36)40(9-4)10-5/h12-19,25-26,29H,6-11,20-24,27H2,1-5H3 |
| InChIKey | UJGYESJDRFZFLL-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|