C20H16N2O3 — CID 58445900
2-(3,6-diamino-3H-xanthen-9-yl)benzoic acid (PubChem CID 58445900) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(3,6-diamino-3H-xanthen-9-yl)benzoic acid.
| Compound Name | 2-(3,6-diamino-3H-xanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 58445900 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-(3,6-diamino-3H-xanthen-9-yl)benzoic acid |
| SMILES | Nc1ccc2c(c1)OC1=CC(N)C=CC1=C2c1ccccc1C(=O)O |
| InChI | InChI=1S/C20H16N2O3/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24/h1-11H,21-22H2,(H,23,24) |
| InChIKey | VWXSNMRTMALSHI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|