C27H24F2N2O3 — CID 126598703
2-[3,6-bis(3-fluoroazetidin-1-yl)-3-methylxanthen-9-yl]benzoic acid (PubChem CID 126598703) has the molecular formula C27H24F2N2O3 and a molecular weight of 462.50 g/mol. Its IUPAC name is 2-[3,6-bis(3-fluoroazetidin-1-yl)-3-methylxanthen-9-yl]benzoic acid.
| Compound Name | 2-[3,6-bis(3-fluoroazetidin-1-yl)-3-methylxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 126598703 |
| Molecular Formula | C27H24F2N2O3 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-[3,6-bis(3-fluoroazetidin-1-yl)-3-methylxanthen-9-yl]benzoic acid |
| SMILES | CC1(N2CC(F)C2)C=CC2=C(c3ccccc3C(=O)O)c3ccc(N4CC(F)C4)cc3OC2=C1 |
| InChI | InChI=1S/C27H24F2N2O3/c1-27(31-14-17(29)15-31)9-8-22-24(11-27)34-23-10-18(30-12-16(28)13-30)6-7-21(23)25(22)19-4-2-3-5-20(19)26(32)33/h2-11,16-17H,12-15H2,1H3,(H,32,33) |
| InChIKey | YLCFDUYPAQTXKZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|