C30H30F2N2O4Si — CID 157240604
carbon dioxide;2-[3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate;methane (PubChem CID 157240604) has the molecular formula C30H30F2N2O4Si and a molecular weight of 548.66 g/mol. Its IUPAC name is carbon dioxide;2-[3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate;methane.
| Compound Name | carbon dioxide;2-[3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate;methane |
|---|---|
| PubChem CID | 157240604 |
| Molecular Formula | C30H30F2N2O4Si |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | carbon dioxide;2-[3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate;methane |
| SMILES | C.C[Si]1(C)C2=CC(=[N+]3CC(F)C3)C=CC2=C(c2ccccc2C(=O)[O-])c2ccc(N3CC(F)C3)cc21.O=C=O |
| InChI | InChI=1S/C28H26F2N2O2Si.CO2.CH4/c1-35(2)25-11-19(31-13-17(29)14-31)7-9-23(25)27(21-5-3-4-6-22(21)28(33)34)24-10-8-20(12-26(24)35)32-15-18(30)16-32;2-1-3;/h3-12,17-18H,13-16H2,1-2H3;;1H4 |
| InChIKey | ZZOACNPCAHRWMM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|