C30H28F3N2O4Si+ — CID 162450135
2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3,5,6-trifluoro-4-methoxycarbonylbenzoic acid (PubChem CID 162450135) has the molecular formula C30H28F3N2O4Si+ and a molecular weight of 565.64 g/mol. Its IUPAC name is 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3,5,6-trifluoro-4-methoxycarbonylbenzoic acid.
| Compound Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3,5,6-trifluoro-4-methoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 162450135 |
| Molecular Formula | C30H28F3N2O4Si+ |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3,5,6-trifluoro-4-methoxycarbonylbenzoic acid |
| SMILES | COC(=O)c1c(F)c(F)c(C(=O)O)c(C2=C3C=CC(=[N+]4CCC4)C=C3[Si](C)(C)c3cc(N4CCC4)ccc32)c1F |
| InChI | InChI=1S/C30H27F3N2O4Si/c1-39-30(38)25-26(31)23(24(29(36)37)27(32)28(25)33)22-18-8-6-16(34-10-4-11-34)14-20(18)40(2,3)21-15-17(7-9-19(21)22)35-12-5-13-35/h6-9,14-15H,4-5,10-13H2,1-3H3/p+1 |
| InChIKey | BKFRNQLOLJAPDO-UHFFFAOYSA-O |
| XLogP | 4.42 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|