C32H27F3N4O2Si — CID 157360313
2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-(1-cyano-1-isocyanoethyl)-3,5,6-trifluorobenzoate (PubChem CID 157360313) has the molecular formula C32H27F3N4O2Si and a molecular weight of 584.67 g/mol. Its IUPAC name is 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-(1-cyano-1-isocyanoethyl)-3,5,6-trifluorobenzoate.
| Compound Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-(1-cyano-1-isocyanoethyl)-3,5,6-trifluorobenzoate |
|---|---|
| PubChem CID | 157360313 |
| Molecular Formula | C32H27F3N4O2Si |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-(1-cyano-1-isocyanoethyl)-3,5,6-trifluorobenzoate |
| SMILES | [C-]#[N+]C(C)(C#N)c1c(F)c(F)c(C(=O)[O-])c(C2=C3C=CC(=[N+]4CCC4)C=C3[Si](C)(C)c3cc(N4CCC4)ccc32)c1F |
| InChI | InChI=1S/C32H27F3N4O2Si/c1-32(17-36,37-2)27-28(33)25(26(31(40)41)29(34)30(27)35)24-20-9-7-18(38-11-5-12-38)15-22(20)42(3,4)23-16-19(8-10-21(23)24)39-13-6-14-39/h7-10,15-16H,5-6,11-14H2,1,3-4H3 |
| InChIKey | BIOHSYBFZSQTLI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|