C30H26F3N3O2Si — CID 162450191
2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3,5,6-trifluoro-4-(isocyanomethyl)benzoate (PubChem CID 162450191) has the molecular formula C30H26F3N3O2Si and a molecular weight of 545.64 g/mol. Its IUPAC name is 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3,5,6-trifluoro-4-(isocyanomethyl)benzoate.
| Compound Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3,5,6-trifluoro-4-(isocyanomethyl)benzoate |
|---|---|
| PubChem CID | 162450191 |
| Molecular Formula | C30H26F3N3O2Si |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-3,5,6-trifluoro-4-(isocyanomethyl)benzoate |
| SMILES | [C-]#[N+]Cc1c(F)c(F)c(C(=O)[O-])c(C2=C3C=CC(=[N+]4CCC4)C=C3[Si](C)(C)c3cc(N4CCC4)ccc32)c1F |
| InChI | InChI=1S/C30H26F3N3O2Si/c1-34-16-21-27(31)25(26(30(37)38)29(33)28(21)32)24-19-8-6-17(35-10-4-11-35)14-22(19)39(2,3)23-15-18(7-9-20(23)24)36-12-5-13-36/h6-9,14-15H,4-5,10-13,16H2,2-3H3 |
| InChIKey | FOPBGICHZRDGPL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|