C29H28N2O4Si — CID 140772579
3-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-carboxybenzoate (PubChem CID 140772579) has the molecular formula C29H28N2O4Si and a molecular weight of 496.64 g/mol. Its IUPAC name is 3-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-carboxybenzoate.
| Compound Name | 3-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-carboxybenzoate |
|---|---|
| PubChem CID | 140772579 |
| Molecular Formula | C29H28N2O4Si |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 3-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-carboxybenzoate |
| SMILES | C[Si]1(C)C2=CC(=[N+]3CCC3)C=CC2=C(c2cc(C(=O)[O-])ccc2C(=O)O)c2ccc(N3CCC3)cc21 |
| InChI | InChI=1S/C29H28N2O4Si/c1-36(2)25-16-19(30-11-3-12-30)6-9-22(25)27(23-10-7-20(17-26(23)36)31-13-4-14-31)24-15-18(28(32)33)5-8-21(24)29(34)35/h5-10,15-17H,3-4,11-14H2,1-2H3,(H-,32,33,34,35) |
| InChIKey | YIPCOENULPIGPZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|