C30H25F4N2O4Si+ — CID 169322722
2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-7-(3,3-difluoroazetidin-1-yl)-5-ethenyl-5-methylbenzo[b][1]benzosilin-10-yl]terephthalic acid (PubChem CID 169322722) has the molecular formula C30H25F4N2O4Si+ and a molecular weight of 581.62 g/mol. Its IUPAC name is 2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-7-(3,3-difluoroazetidin-1-yl)-5-ethenyl-5-methylbenzo[b][1]benzosilin-10-yl]terephthalic acid.
| Compound Name | 2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-7-(3,3-difluoroazetidin-1-yl)-5-ethenyl-5-methylbenzo[b][1]benzosilin-10-yl]terephthalic acid |
|---|---|
| PubChem CID | 169322722 |
| Molecular Formula | C30H25F4N2O4Si+ |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | 2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-7-(3,3-difluoroazetidin-1-yl)-5-ethenyl-5-methylbenzo[b][1]benzosilin-10-yl]terephthalic acid |
| SMILES | C=C[Si]1(C)C2=CC(=[N+]3CC(F)(F)C3)C=CC2=C(c2cc(C(=O)O)ccc2C(=O)O)c2ccc(N3CC(F)(F)C3)cc21 |
| InChI | InChI=1S/C30H24F4N2O4Si/c1-3-41(2)24-11-18(35-13-29(31,32)14-35)5-8-21(24)26(23-10-17(27(37)38)4-7-20(23)28(39)40)22-9-6-19(12-25(22)41)36-15-30(33,34)16-36/h3-12H,1,13-16H2,2H3,(H-,37,38,39,40)/p+1 |
| InChIKey | GUNVHJWWFFZILX-UHFFFAOYSA-O |
| XLogP | 4.50 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|