C40H47ClF2N2O5Si — CID 158841209
4-[4-[2-(6-chlorohexoxy)ethoxy]butanoyl]-2-[3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate (PubChem CID 158841209) has the molecular formula C40H47ClF2N2O5Si and a molecular weight of 737.36 g/mol. Its IUPAC name is 4-[4-[2-(6-chlorohexoxy)ethoxy]butanoyl]-2-[3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate.
| Compound Name | 4-[4-[2-(6-chlorohexoxy)ethoxy]butanoyl]-2-[3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate |
|---|---|
| PubChem CID | 158841209 |
| Molecular Formula | C40H47ClF2N2O5Si |
| Molecular Weight | 737.36 g/mol |
| Exact Mass | 736.29 |
| IUPAC Name | 4-[4-[2-(6-chlorohexoxy)ethoxy]butanoyl]-2-[3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate |
| SMILES | C[Si]1(C)C2=CC(=[N+]3CC(F)C3)C=CC2=C(c2cc(C(=O)CCCOCCOCCCCCCCl)ccc2C(=O)[O-])c2ccc(N3CC(F)C3)cc21 |
| InChI | InChI=1S/C40H47ClF2N2O5Si/c1-51(2)37-21-30(44-23-28(42)24-44)10-13-33(37)39(34-14-11-31(22-38(34)51)45-25-29(43)26-45)35-20-27(9-12-32(35)40(47)48)36(46)8-7-17-50-19-18-49-16-6-4-3-5-15-41/h9-14,20-22,28-29H,3-8,15-19,23-26H2,1-2H3 |
| InChIKey | IYGQJZVLCKULLT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.36 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|