C31H31F2N2O4Si+ — CID 169322672
4-[5-ethenyl-3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5-methylbenzo[b][1]benzosilin-10-yl]-3,5-dimethoxybenzoic acid (PubChem CID 169322672) has the molecular formula C31H31F2N2O4Si+ and a molecular weight of 561.68 g/mol. Its IUPAC name is 4-[5-ethenyl-3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5-methylbenzo[b][1]benzosilin-10-yl]-3,5-dimethoxybenzoic acid.
| Compound Name | 4-[5-ethenyl-3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5-methylbenzo[b][1]benzosilin-10-yl]-3,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 169322672 |
| Molecular Formula | C31H31F2N2O4Si+ |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 4-[5-ethenyl-3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5-methylbenzo[b][1]benzosilin-10-yl]-3,5-dimethoxybenzoic acid |
| SMILES | C=C[Si]1(C)C2=CC(=[N+]3CC(F)C3)C=CC2=C(c2c(OC)cc(C(=O)O)cc2OC)c2ccc(N3CC(F)C3)cc21 |
| InChI | InChI=1S/C31H30F2N2O4Si/c1-5-40(4)27-12-21(34-14-19(32)15-34)6-8-23(27)29(24-9-7-22(13-28(24)40)35-16-20(33)17-35)30-25(38-2)10-18(31(36)37)11-26(30)39-3/h5-13,19-20H,1,14-17H2,2-4H3/p+1 |
| InChIKey | JIHRCSFZRIHFJQ-UHFFFAOYSA-O |
| XLogP | 4.23 |
| TPSA | 62.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|