C25H26N2O2SSi — CID 86269113
3-(3-imino-5,5-dimethyl-7-pyrrolidin-1-ylbenzo[b][1]benzosilin-10-yl)-4-methylthiophene-2-carboxylic acid (PubChem CID 86269113) has the molecular formula C25H26N2O2SSi and a molecular weight of 446.65 g/mol. Its IUPAC name is 3-(3-imino-5,5-dimethyl-7-pyrrolidin-1-ylbenzo[b][1]benzosilin-10-yl)-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-(3-imino-5,5-dimethyl-7-pyrrolidin-1-ylbenzo[b][1]benzosilin-10-yl)-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 86269113 |
| Molecular Formula | C25H26N2O2SSi |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 3-(3-imino-5,5-dimethyl-7-pyrrolidin-1-ylbenzo[b][1]benzosilin-10-yl)-4-methylthiophene-2-carboxylic acid |
| SMILES | [H]/N=C1\C=CC2=C(c3c(C)csc3C(=O)O)c3ccc(N4CCCC4)cc3[Si](C)(C)C2=C1 |
| InChI | InChI=1S/C25H26N2O2SSi/c1-15-14-30-24(25(28)29)22(15)23-18-8-6-16(26)12-20(18)31(2,3)21-13-17(7-9-19(21)23)27-10-4-5-11-27/h6-9,12-14,26H,4-5,10-11H2,1-3H3,(H,28,29)/b26-16+ |
| InChIKey | GUAWKRCIQYRZCY-WGOQTCKBSA-N |
| XLogP | 5.14 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|