C32H33F4N2O2Si+ — CID 162450264
2-(5,5-dimethyl-3-piperidin-1-ium-1-ylidene-7-piperidin-1-ylbenzo[b][1]benzosilin-10-yl)-3,4,5,6-tetrafluorobenzoic acid (PubChem CID 162450264) has the molecular formula C32H33F4N2O2Si+ and a molecular weight of 581.71 g/mol. Its IUPAC name is 2-(5,5-dimethyl-3-piperidin-1-ium-1-ylidene-7-piperidin-1-ylbenzo[b][1]benzosilin-10-yl)-3,4,5,6-tetrafluorobenzoic acid.
| Compound Name | 2-(5,5-dimethyl-3-piperidin-1-ium-1-ylidene-7-piperidin-1-ylbenzo[b][1]benzosilin-10-yl)-3,4,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 162450264 |
| Molecular Formula | C32H33F4N2O2Si+ |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 2-(5,5-dimethyl-3-piperidin-1-ium-1-ylidene-7-piperidin-1-ylbenzo[b][1]benzosilin-10-yl)-3,4,5,6-tetrafluorobenzoic acid |
| SMILES | C[Si]1(C)C2=CC(=[N+]3CCCCC3)C=CC2=C(c2c(F)c(F)c(F)c(F)c2C(=O)O)c2ccc(N3CCCCC3)cc21 |
| InChI | InChI=1S/C32H32F4N2O2Si/c1-41(2)23-17-19(37-13-5-3-6-14-37)9-11-21(23)25(26-27(32(39)40)29(34)31(36)30(35)28(26)33)22-12-10-20(18-24(22)41)38-15-7-4-8-16-38/h9-12,17-18H,3-8,13-16H2,1-2H3/p+1 |
| InChIKey | PYZVLWOUFAPDGV-UHFFFAOYSA-O |
| XLogP | 6.34 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|