C34H36F3N2O2+ — CID 159257086
2-(10,10-dimethyl-3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylanthracen-9-yl)-3,5,6-trifluoro-4-methylbenzoic acid (PubChem CID 159257086) has the molecular formula C34H36F3N2O2+ and a molecular weight of 561.67 g/mol. Its IUPAC name is 2-(10,10-dimethyl-3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylanthracen-9-yl)-3,5,6-trifluoro-4-methylbenzoic acid.
| Compound Name | 2-(10,10-dimethyl-3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylanthracen-9-yl)-3,5,6-trifluoro-4-methylbenzoic acid |
|---|---|
| PubChem CID | 159257086 |
| Molecular Formula | C34H36F3N2O2+ |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | 2-(10,10-dimethyl-3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylanthracen-9-yl)-3,5,6-trifluoro-4-methylbenzoic acid |
| SMILES | Cc1c(F)c(F)c(C(=O)O)c(C2=C3C=CC(=[N+]4CCCCC4)C=C3C(C)(C)c3cc(N4CCCCC4)ccc32)c1F |
| InChI | InChI=1S/C34H35F3N2O2/c1-20-30(35)28(29(33(40)41)32(37)31(20)36)27-23-12-10-21(38-14-6-4-7-15-38)18-25(23)34(2,3)26-19-22(11-13-24(26)27)39-16-8-5-9-17-39/h10-13,18-19H,4-9,14-17H2,1-3H3/p+1 |
| InChIKey | FJZNTYJLTHQBDA-UHFFFAOYSA-O |
| XLogP | 7.33 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|