C30H27F3N5O4P — CID 177267656
4-azido-2,3,5-trifluoro-6-(5-hydroxy-5-oxo-3-piperidin-1-ium-1-ylidene-7-piperidin-1-ylacridophosphin-10-yl)benzoate (PubChem CID 177267656) has the molecular formula C30H27F3N5O4P and a molecular weight of 609.55 g/mol. Its IUPAC name is 4-azido-2,3,5-trifluoro-6-(5-hydroxy-5-oxo-3-piperidin-1-ium-1-ylidene-7-piperidin-1-ylacridophosphin-10-yl)benzoate.
| Compound Name | 4-azido-2,3,5-trifluoro-6-(5-hydroxy-5-oxo-3-piperidin-1-ium-1-ylidene-7-piperidin-1-ylacridophosphin-10-yl)benzoate |
|---|---|
| PubChem CID | 177267656 |
| Molecular Formula | C30H27F3N5O4P |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | 4-azido-2,3,5-trifluoro-6-(5-hydroxy-5-oxo-3-piperidin-1-ium-1-ylidene-7-piperidin-1-ylacridophosphin-10-yl)benzoate |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(C(=O)[O-])c(C2=C3C=CC(=[N+]4CCCCC4)C=C3P(=O)(O)c3cc(N4CCCCC4)ccc32)c1F |
| InChI | InChI=1S/C30H27F3N5O4P/c31-26-25(30(39)40)24(27(32)29(28(26)33)35-36-34)23-19-9-7-17(37-11-3-1-4-12-37)15-21(19)43(41,42)22-16-18(8-10-20(22)23)38-13-5-2-6-14-38/h7-10,15-16H,1-6,11-14H2,(H-,39,40,41,42) |
| InChIKey | CNIROCQTZHMDAZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|